C9H14O5 — CID 67108290
3-hydroxy-5-methoxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 67108290) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-hydroxy-5-methoxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 3-hydroxy-5-methoxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67108290 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-hydroxy-5-methoxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | COC(=O)C1CC(O)CC(C(=O)O)C1 |
| InChI | InChI=1S/C9H14O5/c1-14-9(13)6-2-5(8(11)12)3-7(10)4-6/h5-7,10H,2-4H2,1H3,(H,11,12) |
| InChIKey | BYLITGWUQRRGHZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |