C20H37NO4 — CID 171748856
ditert-butyl 5-(tert-butylamino)cyclohexane-1,3-dicarboxylate (PubChem CID 171748856) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is ditert-butyl 5-(tert-butylamino)cyclohexane-1,3-dicarboxylate.
| Compound Name | ditert-butyl 5-(tert-butylamino)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 171748856 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | ditert-butyl 5-(tert-butylamino)cyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)(C)NC1CC(C(=O)OC(C)(C)C)CC(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H37NO4/c1-18(2,3)21-15-11-13(16(22)24-19(4,5)6)10-14(12-15)17(23)25-20(7,8)9/h13-15,21H,10-12H2,1-9H3 |
| InChIKey | TWXGAOVKDJHEMQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |