C11H20O3 — CID 140895666
tert-butyl 3-(2-hydroxyethyl)cyclobutane-1-carboxylate (PubChem CID 140895666) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxyethyl)cyclobutane-1-carboxylate.
| Compound Name | tert-butyl 3-(2-hydroxyethyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 140895666 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | tert-butyl 3-(2-hydroxyethyl)cyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(CCO)C1 |
| InChI | InChI=1S/C11H20O3/c1-11(2,3)14-10(13)9-6-8(7-9)4-5-12/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | WKLCFKLSMHQKMT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |