C14H29NO3Si — CID 141378656
tert-butyl (2R,4R)-4-(2-hydroxyethyl)-1-trimethylsilylpyrrolidine-2-carboxylate (PubChem CID 141378656) has the molecular formula C14H29NO3Si and a molecular weight of 287.48 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-(2-hydroxyethyl)-1-trimethylsilylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-(2-hydroxyethyl)-1-trimethylsilylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141378656 |
| Molecular Formula | C14H29NO3Si |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl (2R,4R)-4-(2-hydroxyethyl)-1-trimethylsilylpyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@H](CCO)CN1[Si](C)(C)C |
| InChI | InChI=1S/C14H29NO3Si/c1-14(2,3)18-13(17)12-9-11(7-8-16)10-15(12)19(4,5)6/h11-12,16H,7-10H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | UZSOHXNUMNPXNE-NWDGAFQWSA-N |
| XLogP | 2.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|