C16H26O5 — CID 10924504
ditert-butyl (1R,3S,4S,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 10924504) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ditert-butyl (1R,3S,4S,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | ditert-butyl (1R,3S,4S,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10924504 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ditert-butyl (1R,3S,4S,6R)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@H]2O[C@@H]2C[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26O5/c1-15(2,3)20-13(17)9-7-11-12(19-11)8-10(9)14(18)21-16(4,5)6/h9-12H,7-8H2,1-6H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | NCBIWVAAAWSMLG-NNYUYHANSA-N |
| XLogP | 2.46 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|