C27H44O8 — CID 11431939
tetratert-butyl bicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate (PubChem CID 11431939) has the molecular formula C27H44O8 and a molecular weight of 496.64 g/mol. Its IUPAC name is tetratert-butyl bicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate.
| Compound Name | tetratert-butyl bicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 11431939 |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | tetratert-butyl bicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2CC(C1C(=O)OC(C)(C)C)C(C(=O)OC(C)(C)C)C2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H44O8/c1-24(2,3)32-20(28)16-14-13-15(17(16)21(29)33-25(4,5)6)19(23(31)35-27(10,11)12)18(14)22(30)34-26(7,8)9/h14-19H,13H2,1-12H3 |
| InChIKey | GIYRFYYNQHKBKQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|