C13H23NO2 — CID 155486891
tert-butyl (1R,5S)-3-aminobicyclo[3.2.1]octane-8-carboxylate (PubChem CID 155486891) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-aminobicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,5S)-3-aminobicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 155486891 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl (1R,5S)-3-aminobicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1[C@@H]2CC[C@H]1CC(N)C2 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)16-12(15)11-8-4-5-9(11)7-10(14)6-8/h8-11H,4-7,14H2,1-3H3/t8-,9+,10?,11? |
| InChIKey | ZCLHRPOKTQSBAR-IXBNRNDTSA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |