C14H26O2 — CID 91480700
tert-butyl bicyclo[2.2.1]heptane-2-carboxylate;ethane (PubChem CID 91480700) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is tert-butyl bicyclo[2.2.1]heptane-2-carboxylate;ethane.
| Compound Name | tert-butyl bicyclo[2.2.1]heptane-2-carboxylate;ethane |
|---|---|
| PubChem CID | 91480700 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | tert-butyl bicyclo[2.2.1]heptane-2-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H20O2.C2H6/c1-12(2,3)14-11(13)10-7-8-4-5-9(10)6-8;1-2/h8-10H,4-7H2,1-3H3;1-2H3 |
| InChIKey | KKOFWVAYPKHBAS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |