C12H13F6O5S- — CID 59445699
2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 59445699) has the molecular formula C12H13F6O5S- and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 59445699 |
| Molecular Formula | C12H13F6O5S- |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=C(OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H14F6O5S/c13-11(14,15)10(12(16,17)18,5-24(20,21)22)23-9(19)8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H,20,21,22)/p-1 |
| InChIKey | MEIFKUWURDIVJG-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|