C13H17F3O4 — CID 158249913
prop-2-enoic acid;2,2,2-trifluoroethyl bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 158249913) has the molecular formula C13H17F3O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is prop-2-enoic acid;2,2,2-trifluoroethyl bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | prop-2-enoic acid;2,2,2-trifluoroethyl bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158249913 |
| Molecular Formula | C13H17F3O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | prop-2-enoic acid;2,2,2-trifluoroethyl bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=CC(=O)O.O=C(OCC(F)(F)F)C1CC2CCC1C2 |
| InChI | InChI=1S/C10H13F3O2.C3H4O2/c11-10(12,13)5-15-9(14)8-4-6-1-2-7(8)3-6;1-2-3(4)5/h6-8H,1-5H2;2H,1H2,(H,4,5) |
| InChIKey | GGOXHJLLTJUGSD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|