C22H35F3O5 — CID 91226462
methyl 2-methylprop-2-enoate;(8,8,8-trifluoro-7-hydroxy-7-methyloctyl) bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 91226462) has the molecular formula C22H35F3O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;(8,8,8-trifluoro-7-hydroxy-7-methyloctyl) bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl 2-methylprop-2-enoate;(8,8,8-trifluoro-7-hydroxy-7-methyloctyl) bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91226462 |
| Molecular Formula | C22H35F3O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl 2-methylprop-2-enoate;(8,8,8-trifluoro-7-hydroxy-7-methyloctyl) bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C(C)C(=O)OC.CC(O)(CCCCCCOC(=O)C1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C17H27F3O3.C5H8O2/c1-16(22,17(18,19)20)8-4-2-3-5-9-23-15(21)14-11-12-6-7-13(14)10-12;1-4(2)5(6)7-3/h12-14,22H,2-11H2,1H3;1H2,2-3H3 |
| InChIKey | WXFALJFEDJMZHD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|