About 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane
2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane (PubChem CID 91028448) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane.
Molecular Properties
| Compound Name | 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane |
| PubChem CID | 91028448 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane |
| SMILES | CC(C)C.O=C(OCCO)C1CC2CCC1C2 |
| InChI | InChI=1S/C10H16O3.C4H10/c11-3-4-13-10(12)9-6-7-1-2-8(9)5-7;1-4(2)3/h7-9,11H,1-6H2;4H,1-3H3 |
| InChIKey | KQXQEKVGJSGSPR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane?
The IUPAC name of 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane (CID 91028448) is 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane.
What is the SMILES notation for 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane?
The canonical SMILES for 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane is CC(C)C.O=C(OCCO)C1CC2CCC1C2.
What is the InChIKey of 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane?
The InChIKey is KQXQEKVGJSGSPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3.C4H10/c11-3-4-13-10(12)9-6-7-1-2-8(9)5-7;1-4(2)3/h7-9,11H,1-6H2;4H,1-3H3.
What are the key properties of 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane?
2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane has a molecular weight of 242.36 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl bicyclo[2.2.1]heptane-2-carboxylate;2-methylpropane is sourced from PubChem (CID 91028448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).