C18H34NO2+ — CID 155170635
2-[(4S)-bicyclo[2.2.1]heptane-2-carbonyl]oxyethyl-ethyl-dipropylazanium (PubChem CID 155170635) has the molecular formula C18H34NO2+ and a molecular weight of 296.47 g/mol. Its IUPAC name is 2-[(4S)-bicyclo[2.2.1]heptane-2-carbonyl]oxyethyl-ethyl-dipropylazanium.
| Compound Name | 2-[(4S)-bicyclo[2.2.1]heptane-2-carbonyl]oxyethyl-ethyl-dipropylazanium |
|---|---|
| PubChem CID | 155170635 |
| Molecular Formula | C18H34NO2+ |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 2-[(4S)-bicyclo[2.2.1]heptane-2-carbonyl]oxyethyl-ethyl-dipropylazanium |
| SMILES | CCC[N+](CC)(CCC)CCOC(=O)C1C[C@H]2CCC1C2 |
| InChI | InChI=1S/C18H34NO2/c1-4-9-19(6-3,10-5-2)11-12-21-18(20)17-14-15-7-8-16(17)13-15/h15-17H,4-14H2,1-3H3/q+1/t15-,16?,17?/m0/s1 |
| InChIKey | OSNWSEMZNDTWSN-GTPINHCMSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|