About S-propyl bicyclo[2.2.1]heptane-2-carbothioate
S-propyl bicyclo[2.2.1]heptane-2-carbothioate (PubChem CID 121296216) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is S-propyl bicyclo[2.2.1]heptane-2-carbothioate.
Molecular Properties
| Compound Name | S-propyl bicyclo[2.2.1]heptane-2-carbothioate |
| PubChem CID | 121296216 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | S-propyl bicyclo[2.2.1]heptane-2-carbothioate |
| SMILES | CCCSC(=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C11H18OS/c1-2-5-13-11(12)10-7-8-3-4-9(10)6-8/h8-10H,2-7H2,1H3 |
| InChIKey | GWXYOUXCZNVECG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propyl bicyclo[2.2.1]heptane-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propyl bicyclo[2.2.1]heptane-2-carbothioate?
The IUPAC name of S-propyl bicyclo[2.2.1]heptane-2-carbothioate (CID 121296216) is S-propyl bicyclo[2.2.1]heptane-2-carbothioate.
What is the SMILES notation for S-propyl bicyclo[2.2.1]heptane-2-carbothioate?
The canonical SMILES for S-propyl bicyclo[2.2.1]heptane-2-carbothioate is CCCSC(=O)C1CC2CCC1C2.
What is the InChIKey of S-propyl bicyclo[2.2.1]heptane-2-carbothioate?
The InChIKey is GWXYOUXCZNVECG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OS/c1-2-5-13-11(12)10-7-8-3-4-9(10)6-8/h8-10H,2-7H2,1H3.
What are the key properties of S-propyl bicyclo[2.2.1]heptane-2-carbothioate?
S-propyl bicyclo[2.2.1]heptane-2-carbothioate has a molecular weight of 198.33 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propyl bicyclo[2.2.1]heptane-2-carbothioate is sourced from PubChem (CID 121296216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).