C8H11O2- — CID 19564455
(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 19564455) has the molecular formula C8H11O2- and a molecular weight of 139.17 g/mol. Its IUPAC name is (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 19564455 |
| Molecular Formula | C8H11O2- |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H12O2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,9,10)/p-1/t5-,6+,7-/m1/s1 |
| InChIKey | JESWDXIHOJGWBP-DSYKOEDSSA-M |
| XLogP | 0.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |