C9H12F2O — CID 14435685
1-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoroethanone (PubChem CID 14435685) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoroethanone.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 14435685 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)C1CC2CCC1C2 |
| InChI | InChI=1S/C9H12F2O/c10-9(11)8(12)7-4-5-1-2-6(7)3-5/h5-7,9H,1-4H2 |
| InChIKey | GPQFXOKFKAZCEK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |