C9H11ClF2O — CID 130494478
1-(2-bicyclo[2.2.1]heptanyl)-2-chloro-2,2-difluoroethanone (PubChem CID 130494478) has the molecular formula C9H11ClF2O and a molecular weight of 208.63 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-chloro-2,2-difluoroethanone.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-chloro-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130494478 |
| Molecular Formula | C9H11ClF2O |
| Molecular Weight | 208.63 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-chloro-2,2-difluoroethanone |
| SMILES | O=C(C1CC2CCC1C2)C(F)(F)Cl |
| InChI | InChI=1S/C9H11ClF2O/c10-9(11,12)8(13)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2 |
| InChIKey | FXRZBDNPLKFHLM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|