C8H11N3O — CID 11819378
(1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl azide (PubChem CID 11819378) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl azide.
| Compound Name | (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl azide |
|---|---|
| PubChem CID | 11819378 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (1S,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)[C@@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H11N3O/c9-11-10-8(12)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7-/m1/s1 |
| InChIKey | XLOCYOCDOLINDL-DSYKOEDSSA-N |
| XLogP | 2.26 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|