C8H14N2O — CID 6993760
(1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbohydrazide (PubChem CID 6993760) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbohydrazide.
| Compound Name | (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbohydrazide |
|---|---|
| PubChem CID | 6993760 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H14N2O/c9-10-8(11)7-4-5-1-2-6(7)3-5/h5-7H,1-4,9H2,(H,10,11)/t5-,6-,7+/m0/s1 |
| InChIKey | MPUCEIOQZPZIJZ-LYFYHCNISA-N |
| XLogP | 0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|