C18H26CaO4 — CID 140572510
calcium bis((2R)-bicyclo[2.2.2]octane-2-carboxylate) (PubChem CID 140572510) has the molecular formula C18H26CaO4 and a molecular weight of 346.48 g/mol. Its IUPAC name is calcium bis((2R)-bicyclo[2.2.2]octane-2-carboxylate).
| Compound Name | calcium bis((2R)-bicyclo[2.2.2]octane-2-carboxylate) |
|---|---|
| PubChem CID | 140572510 |
| Molecular Formula | C18H26CaO4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | calcium bis((2R)-bicyclo[2.2.2]octane-2-carboxylate) |
| SMILES | O=C([O-])[C@@H]1CC2CCC1CC2.O=C([O-])[C@@H]1CC2CCC1CC2.[Ca+2] |
| InChI | InChI=1S/2C9H14O2.Ca/c2*10-9(11)8-5-6-1-3-7(8)4-2-6;/h2*6-8H,1-5H2,(H,10,11);/q;;+2/p-2/t2*6?,7?,8-;/m11./s1 |
| InChIKey | DCSKIRGWTHEYIH-URIAWATPSA-L |
| XLogP | 0.74 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |