C14H23NO3 — CID 59204120
2-morpholin-4-ylethyl bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59204120) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59204120 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-morpholin-4-ylethyl bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OCCN1CCOCC1)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H23NO3/c16-14(13-10-11-1-2-12(13)9-11)18-8-5-15-3-6-17-7-4-15/h11-13H,1-10H2 |
| InChIKey | LQIDAGYDSKRULY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |