About 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride
2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride (PubChem CID 118522364) has the molecular formula C12H23ClN2O3
and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride |
| PubChem CID | 118522364 |
| Molecular Formula | C12H23ClN2O3 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCOCC1)C1CCNCC1 |
| InChI | InChI=1S/C12H22N2O3.ClH/c15-12(11-1-3-13-4-2-11)17-10-7-14-5-8-16-9-6-14;/h11,13H,1-10H2;1H |
| InChIKey | OGNMEDMKPGTJJS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride (CID 118522364) is 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride is Cl.O=C(OCCN1CCOCC1)C1CCNCC1.
What is the InChIKey of 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride?
The InChIKey is OGNMEDMKPGTJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3.ClH/c15-12(11-1-3-13-4-2-11)17-10-7-14-5-8-16-9-6-14;/h11,13H,1-10H2;1H.
What are the key properties of 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride?
2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride has a molecular weight of 278.78 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl piperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 118522364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).