C15H26N4O4 — CID 108518524
N-(3-morpholin-4-ylpropyl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108518524) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108518524 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C15H26N4O4/c20-13(12-2-5-16-6-3-12)18-15(22)14(21)17-4-1-7-19-8-10-23-11-9-19/h12,16H,1-11H2,(H,17,21)(H,18,20,22) |
| InChIKey | LXCZVDFOCHZETH-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|