C11H18ClN3O3 — CID 108513799
N-(3-chloropropyl)-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108513799) has the molecular formula C11H18ClN3O3 and a molecular weight of 275.74 g/mol. Its IUPAC name is N-(3-chloropropyl)-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-(3-chloropropyl)-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108513799 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-(3-chloropropyl)-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NCCCCl)C(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C11H18ClN3O3/c12-4-1-5-14-10(17)11(18)15-9(16)8-2-6-13-7-3-8/h8,13H,1-7H2,(H,14,17)(H,15,16,18) |
| InChIKey | QZTCEMDYYAZVMC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|