C18H25N3O5 — CID 108506308
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108506308) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108506308 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NC(=O)C2CCNCC2)cc1OC |
| InChI | InChI=1S/C18H25N3O5/c1-25-14-4-3-12(11-15(14)26-2)5-10-20-17(23)18(24)21-16(22)13-6-8-19-9-7-13/h3-4,11,13,19H,5-10H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | JGRZOIYNIYUMLD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|