C14H29N3O3 — CID 177180760
2-amino-6-(piperidine-4-carbonylamino)hexanoic acid;ethane (PubChem CID 177180760) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-amino-6-(piperidine-4-carbonylamino)hexanoic acid;ethane.
| Compound Name | 2-amino-6-(piperidine-4-carbonylamino)hexanoic acid;ethane |
|---|---|
| PubChem CID | 177180760 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-amino-6-(piperidine-4-carbonylamino)hexanoic acid;ethane |
| SMILES | CC.NC(CCCCNC(=O)C1CCNCC1)C(=O)O |
| InChI | InChI=1S/C12H23N3O3.C2H6/c13-10(12(17)18)3-1-2-6-15-11(16)9-4-7-14-8-5-9;1-2/h9-10,14H,1-8,13H2,(H,15,16)(H,17,18);1-2H3 |
| InChIKey | ZEYSFSHXJYODSH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|