C15H33N3O — CID 142349997
ethane;molecular hydrogen;N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 142349997) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is ethane;molecular hydrogen;N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | ethane;molecular hydrogen;N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142349997 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | ethane;molecular hydrogen;N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | CC.O=C(NCCCN1CCCC1)C1CCNCC1.[H][H] |
| InChI | InChI=1S/C13H25N3O.C2H6.H2/c17-13(12-4-7-14-8-5-12)15-6-3-11-16-9-1-2-10-16;1-2;/h12,14H,1-11H2,(H,15,17);1-2H3;1H |
| InChIKey | QDYNQMPYGMTRPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|