C13H26ClN3O — CID 67293748
(3R)-N-(3-piperidin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 67293748) has the molecular formula C13H26ClN3O and a molecular weight of 275.82 g/mol. Its IUPAC name is (3R)-N-(3-piperidin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R)-N-(3-piperidin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67293748 |
| Molecular Formula | C13H26ClN3O |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | (3R)-N-(3-piperidin-1-ylpropyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCCCC1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C13H25N3O.ClH/c17-13(12-5-7-14-11-12)15-6-4-10-16-8-2-1-3-9-16;/h12,14H,1-11H2,(H,15,17);1H/t12-;/m1./s1 |
| InChIKey | KYQINMNYIJDYGG-UTONKHPSSA-N |
| XLogP | 1.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|