C15H33Cl3N4O — CID 119901823
N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide;trihydrochloride (PubChem CID 119901823) has the molecular formula C15H33Cl3N4O and a molecular weight of 391.82 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide;trihydrochloride.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide;trihydrochloride |
|---|---|
| PubChem CID | 119901823 |
| Molecular Formula | C15H33Cl3N4O |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide;trihydrochloride |
| SMILES | CCN1CCN(CCCNC(=O)C2CCCNC2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C15H30N4O.3ClH/c1-2-18-9-11-19(12-10-18)8-4-7-17-15(20)14-5-3-6-16-13-14;;;/h14,16H,2-13H2,1H3,(H,17,20);3*1H |
| InChIKey | VQQIVFPDVAYSCZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|