C15H31Cl2N3O — CID 119831193
N-[3-(azepan-1-yl)propyl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119831193) has the molecular formula C15H31Cl2N3O and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[3-(azepan-1-yl)propyl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119831193 |
| Molecular Formula | C15H31Cl2N3O |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCCCCC1)C1CCCNC1 |
| InChI | InChI=1S/C15H29N3O.2ClH/c19-15(14-7-5-8-16-13-14)17-9-6-12-18-10-3-1-2-4-11-18;;/h14,16H,1-13H2,(H,17,19);2*1H |
| InChIKey | PVWUPQPYBZZVRR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|