C20H43N3O2 — CID 172589491
ethane;1-methylpyrrolidine;N-(4-oxopentyl)piperidine-4-carboxamide (PubChem CID 172589491) has the molecular formula C20H43N3O2 and a molecular weight of 357.58 g/mol. Its IUPAC name is ethane;1-methylpyrrolidine;N-(4-oxopentyl)piperidine-4-carboxamide.
| Compound Name | ethane;1-methylpyrrolidine;N-(4-oxopentyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 172589491 |
| Molecular Formula | C20H43N3O2 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.34 |
| IUPAC Name | ethane;1-methylpyrrolidine;N-(4-oxopentyl)piperidine-4-carboxamide |
| SMILES | CC.CC.CC(=O)CCCNC(=O)C1CCNCC1.CN1CCCC1 |
| InChI | InChI=1S/C11H20N2O2.C5H11N.2C2H6/c1-9(14)3-2-6-13-11(15)10-4-7-12-8-5-10;1-6-4-2-3-5-6;2*1-2/h10,12H,2-8H2,1H3,(H,13,15);2-5H2,1H3;2*1-2H3 |
| InChIKey | KINLMSKPROSBTQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|