C17H37N3O — CID 144702617
ethane;1-methyl-N-(piperidin-4-ylmethyl)piperidine-4-carboxamide (PubChem CID 144702617) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is ethane;1-methyl-N-(piperidin-4-ylmethyl)piperidine-4-carboxamide.
| Compound Name | ethane;1-methyl-N-(piperidin-4-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 144702617 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | ethane;1-methyl-N-(piperidin-4-ylmethyl)piperidine-4-carboxamide |
| SMILES | CC.CC.CN1CCC(C(=O)NCC2CCNCC2)CC1 |
| InChI | InChI=1S/C13H25N3O.2C2H6/c1-16-8-4-12(5-9-16)13(17)15-10-11-2-6-14-7-3-11;2*1-2/h11-12,14H,2-10H2,1H3,(H,15,17);2*1-2H3 |
| InChIKey | HUTFDKIZHRXADP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |