About methane;N-(piperidin-4-ylmethyl)acetamide
methane;N-(piperidin-4-ylmethyl)acetamide (PubChem CID 161365348) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is methane;N-(piperidin-4-ylmethyl)acetamide.
Molecular Properties
| Compound Name | methane;N-(piperidin-4-ylmethyl)acetamide |
| PubChem CID | 161365348 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | methane;N-(piperidin-4-ylmethyl)acetamide |
| SMILES | C.CC(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C8H16N2O.CH4/c1-7(11)10-6-8-2-4-9-5-3-8;/h8-9H,2-6H2,1H3,(H,10,11);1H4 |
| InChIKey | VPSVZVUTECXHAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;N-(piperidin-4-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-(piperidin-4-ylmethyl)acetamide?
The IUPAC name of methane;N-(piperidin-4-ylmethyl)acetamide (CID 161365348) is methane;N-(piperidin-4-ylmethyl)acetamide.
What is the SMILES notation for methane;N-(piperidin-4-ylmethyl)acetamide?
The canonical SMILES for methane;N-(piperidin-4-ylmethyl)acetamide is C.CC(=O)NCC1CCNCC1.
What is the InChIKey of methane;N-(piperidin-4-ylmethyl)acetamide?
The InChIKey is VPSVZVUTECXHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.CH4/c1-7(11)10-6-8-2-4-9-5-3-8;/h8-9H,2-6H2,1H3,(H,10,11);1H4.
What are the key properties of methane;N-(piperidin-4-ylmethyl)acetamide?
methane;N-(piperidin-4-ylmethyl)acetamide has a molecular weight of 172.27 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-(piperidin-4-ylmethyl)acetamide is sourced from PubChem (CID 161365348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).