C9H17N3O2 — CID 17019739
(2E)-2-hydroxyimino-N-(piperidin-4-ylmethyl)propanamide (PubChem CID 17019739) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-(piperidin-4-ylmethyl)propanamide.
| Compound Name | (2E)-2-hydroxyimino-N-(piperidin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 17019739 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (2E)-2-hydroxyimino-N-(piperidin-4-ylmethyl)propanamide |
| SMILES | C/C(=N\O)C(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C9H17N3O2/c1-7(12-14)9(13)11-6-8-2-4-10-5-3-8/h8,10,14H,2-6H2,1H3,(H,11,13)/b12-7+ |
| InChIKey | LLMMROALTGZYNZ-KPKJPENVSA-N |
| XLogP | -0.05 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|