C8H16N2O3S — CID 84685887
2-oxo-2-(piperidin-4-ylmethylamino)ethanesulfinic acid (PubChem CID 84685887) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-oxo-2-(piperidin-4-ylmethylamino)ethanesulfinic acid.
| Compound Name | 2-oxo-2-(piperidin-4-ylmethylamino)ethanesulfinic acid |
|---|---|
| PubChem CID | 84685887 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-oxo-2-(piperidin-4-ylmethylamino)ethanesulfinic acid |
| SMILES | O=C(CS(=O)O)NCC1CCNCC1 |
| InChI | InChI=1S/C8H16N2O3S/c11-8(6-14(12)13)10-5-7-1-3-9-4-2-7/h7,9H,1-6H2,(H,10,11)(H,12,13) |
| InChIKey | AWRHOMQQNJWBSU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|