C16H21FN2O — CID 86779897
(Z)-3-(4-fluorophenyl)-2-methyl-N-(piperidin-4-ylmethyl)prop-2-enamide (PubChem CID 86779897) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is (Z)-3-(4-fluorophenyl)-2-methyl-N-(piperidin-4-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-fluorophenyl)-2-methyl-N-(piperidin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 86779897 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (Z)-3-(4-fluorophenyl)-2-methyl-N-(piperidin-4-ylmethyl)prop-2-enamide |
| SMILES | C/C(=C/c1ccc(F)cc1)C(=O)NCC1CCNCC1 |
| InChI | InChI=1S/C16H21FN2O/c1-12(10-13-2-4-15(17)5-3-13)16(20)19-11-14-6-8-18-9-7-14/h2-5,10,14,18H,6-9,11H2,1H3,(H,19,20)/b12-10- |
| InChIKey | AJVMLOIVMIRXOW-BENRWUELSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|