About 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene
4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene (PubChem CID 142509357) has the molecular formula C23H31FN2O2
and a molecular weight of 386.51 g/mol. Its IUPAC name is 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene.
Molecular Properties
| Compound Name | 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene |
| PubChem CID | 142509357 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene |
| SMILES | CCCOCc1ccccc1.O=C(NCC1CCNCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2O.C10H14O/c14-12-3-1-11(2-4-12)13(17)16-9-10-5-7-15-8-6-10;1-2-8-11-9-10-6-4-3-5-7-10/h1-4,10,15H,5-9H2,(H,16,17);3-7H,2,8-9H2,1H3 |
| InChIKey | LPOZQSHQKHZHQT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene?
The IUPAC name of 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene (CID 142509357) is 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene.
What is the SMILES notation for 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene?
The canonical SMILES for 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene is CCCOCc1ccccc1.O=C(NCC1CCNCC1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene?
The InChIKey is LPOZQSHQKHZHQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2O.C10H14O/c14-12-3-1-11(2-4-12)13(17)16-9-10-5-7-15-8-6-10;1-2-8-11-9-10-6-4-3-5-7-10/h1-4,10,15H,5-9H2,(H,16,17);3-7H,2,8-9H2,1H3.
What are the key properties of 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene?
4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene has a molecular weight of 386.51 g/mol, XLogP of 4.17, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene is sourced from PubChem (CID 142509357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).