C23H31FN2O2 — CID 142509357
4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene (PubChem CID 142509357) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene.
| Compound Name | 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene |
|---|---|
| PubChem CID | 142509357 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-fluoro-N-(piperidin-4-ylmethyl)benzamide;propoxymethylbenzene |
| SMILES | CCCOCc1ccccc1.O=C(NCC1CCNCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2O.C10H14O/c14-12-3-1-11(2-4-12)13(17)16-9-10-5-7-15-8-6-10;1-2-8-11-9-10-6-4-3-5-7-10/h1-4,10,15H,5-9H2,(H,16,17);3-7H,2,8-9H2,1H3 |
| InChIKey | LPOZQSHQKHZHQT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|