C22H36N2O3 — CID 174760700
tert-butyl formate;4-tert-butyl-N-(piperidin-4-ylmethyl)benzamide (PubChem CID 174760700) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl formate;4-tert-butyl-N-(piperidin-4-ylmethyl)benzamide.
| Compound Name | tert-butyl formate;4-tert-butyl-N-(piperidin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 174760700 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl formate;4-tert-butyl-N-(piperidin-4-ylmethyl)benzamide |
| SMILES | CC(C)(C)OC=O.CC(C)(C)c1ccc(C(=O)NCC2CCNCC2)cc1 |
| InChI | InChI=1S/C17H26N2O.C5H10O2/c1-17(2,3)15-6-4-14(5-7-15)16(20)19-12-13-8-10-18-11-9-13;1-5(2,3)7-4-6/h4-7,13,18H,8-12H2,1-3H3,(H,19,20);4H,1-3H3 |
| InChIKey | ZJLDZCYJNOYAJX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|