C25H30N2OS — CID 164889338
5-(4-tert-butylphenyl)-N-(piperidin-4-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 164889338) has the molecular formula C25H30N2OS and a molecular weight of 406.60 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-N-(piperidin-4-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-(4-tert-butylphenyl)-N-(piperidin-4-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 164889338 |
| Molecular Formula | C25H30N2OS |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-(4-tert-butylphenyl)-N-(piperidin-4-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2ccc3sc(C(=O)NCC4CCNCC4)cc3c2)cc1 |
| InChI | InChI=1S/C25H30N2OS/c1-25(2,3)21-7-4-18(5-8-21)19-6-9-22-20(14-19)15-23(29-22)24(28)27-16-17-10-12-26-13-11-17/h4-9,14-15,17,26H,10-13,16H2,1-3H3,(H,27,28) |
| InChIKey | CRTNJGCENGXQLV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |