C14H16N2OS2 — CID 107294726
5-amino-N-(thiolan-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 107294726) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-amino-N-(thiolan-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(thiolan-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107294726 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-amino-N-(thiolan-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)NCC3CCSC3)cc2c1 |
| InChI | InChI=1S/C14H16N2OS2/c15-11-1-2-12-10(5-11)6-13(19-12)14(17)16-7-9-3-4-18-8-9/h1-2,5-6,9H,3-4,7-8,15H2,(H,16,17) |
| InChIKey | HXZGIEKRBWRQRI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|