C11H10F2N2OS — CID 113303500
5-amino-N-(2,2-difluoroethyl)-1-benzothiophene-2-carboxamide (PubChem CID 113303500) has the molecular formula C11H10F2N2OS and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoroethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(2,2-difluoroethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 113303500 |
| Molecular Formula | C11H10F2N2OS |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-amino-N-(2,2-difluoroethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)NCC(F)F)cc2c1 |
| InChI | InChI=1S/C11H10F2N2OS/c12-10(13)5-15-11(16)9-4-6-3-7(14)1-2-8(6)17-9/h1-4,10H,5,14H2,(H,15,16) |
| InChIKey | XARAOEIXYCIEDB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|