C12H11F3N2OS — CID 55174937
5-amino-N-(3,3,3-trifluoropropyl)-1-benzothiophene-2-carboxamide (PubChem CID 55174937) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 5-amino-N-(3,3,3-trifluoropropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(3,3,3-trifluoropropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55174937 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-amino-N-(3,3,3-trifluoropropyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)NCCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)3-4-17-11(18)10-6-7-5-8(16)1-2-9(7)19-10/h1-2,5-6H,3-4,16H2,(H,17,18) |
| InChIKey | QYEWZJQJNJWFAE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|