C11H13N3O3S2 — CID 61093849
5-amino-N-(2-sulfamoylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 61093849) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-amino-N-(2-sulfamoylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(2-sulfamoylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 61093849 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-amino-N-(2-sulfamoylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)NCCS(N)(=O)=O)cc2c1 |
| InChI | InChI=1S/C11H13N3O3S2/c12-8-1-2-9-7(5-8)6-10(18-9)11(15)14-3-4-19(13,16)17/h1-2,5-6H,3-4,12H2,(H,14,15)(H2,13,16,17) |
| InChIKey | FMPFFPUUBPOXIP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|