C13H11N3O2S — CID 81170386
5-amino-N-(1,2-oxazol-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 81170386) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-amino-N-(1,2-oxazol-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(1,2-oxazol-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81170386 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-amino-N-(1,2-oxazol-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc2sc(C(=O)NCc3ccon3)cc2c1 |
| InChI | InChI=1S/C13H11N3O2S/c14-9-1-2-11-8(5-9)6-12(19-11)13(17)15-7-10-3-4-18-16-10/h1-6H,7,14H2,(H,15,17) |
| InChIKey | ZCVASRNBGIQSEI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|