C15H15N3O2S — CID 79223728
5-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 79223728) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 5-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79223728 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1noc(C)c1CNC(=O)c1cc2cc(N)ccc2s1 |
| InChI | InChI=1S/C15H15N3O2S/c1-8-12(9(2)20-18-8)7-17-15(19)14-6-10-5-11(16)3-4-13(10)21-14/h3-6H,7,16H2,1-2H3,(H,17,19) |
| InChIKey | JAEXERLDYUYULX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|