C31H28N2O3S — CID 155563587
4,5-bis[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)thiophene-2-carboxamide (PubChem CID 155563587) has the molecular formula C31H28N2O3S and a molecular weight of 508.64 g/mol. Its IUPAC name is 4,5-bis[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-bis[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155563587 |
| Molecular Formula | C31H28N2O3S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 4,5-bis[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCNCC1)c1cc(-c2ccc(-c3ccoc3)cc2)c(-c2ccc(-c3ccoc3)cc2)s1 |
| InChI | InChI=1S/C31H28N2O3S/c34-31(33-18-21-9-13-32-14-10-21)29-17-28(24-5-1-22(2-6-24)26-11-15-35-19-26)30(37-29)25-7-3-23(4-8-25)27-12-16-36-20-27/h1-8,11-12,15-17,19-21,32H,9-10,13-14,18H2,(H,33,34) |
| InChIKey | GOZSENVKDRJTND-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |