C20H22N2O3 — CID 172553823
6-(furan-3-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 172553823) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-(furan-3-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 6-(furan-3-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 172553823 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 6-(furan-3-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | CN1CCC(CNC(=O)c2cc3ccc(-c4ccoc4)cc3o2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c1-22-7-4-14(5-8-22)12-21-20(23)19-11-16-3-2-15(10-18(16)25-19)17-6-9-24-13-17/h2-3,6,9-11,13-14H,4-5,7-8,12H2,1H3,(H,21,23) |
| InChIKey | MUHQBSVENLQOSW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |