C24H26N6O — CID 171446161
5-(1-aminoisoquinolin-7-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1H-indazole-3-carboxamide (PubChem CID 171446161) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-(1-aminoisoquinolin-7-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-(1-aminoisoquinolin-7-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 171446161 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5-(1-aminoisoquinolin-7-yl)-N-[(1-methylpiperidin-4-yl)methyl]-1H-indazole-3-carboxamide |
| SMILES | CN1CCC(CNC(=O)c2n[nH]c3ccc(-c4ccc5ccnc(N)c5c4)cc23)CC1 |
| InChI | InChI=1S/C24H26N6O/c1-30-10-7-15(8-11-30)14-27-24(31)22-20-13-18(4-5-21(20)28-29-22)17-3-2-16-6-9-26-23(25)19(16)12-17/h2-6,9,12-13,15H,7-8,10-11,14H2,1H3,(H2,25,26)(H,27,31)(H,28,29) |
| InChIKey | BPOKQGUQQNGFFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |