C24H25N5O2 — CID 171446035
5-(1-aminoisoquinolin-7-yl)-N-[(4-hydroxycyclohexyl)methyl]-1H-indazole-3-carboxamide (PubChem CID 171446035) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 5-(1-aminoisoquinolin-7-yl)-N-[(4-hydroxycyclohexyl)methyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-(1-aminoisoquinolin-7-yl)-N-[(4-hydroxycyclohexyl)methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 171446035 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-(1-aminoisoquinolin-7-yl)-N-[(4-hydroxycyclohexyl)methyl]-1H-indazole-3-carboxamide |
| SMILES | Nc1nccc2ccc(-c3ccc4[nH]nc(C(=O)NCC5CCC(O)CC5)c4c3)cc12 |
| InChI | InChI=1S/C24H25N5O2/c25-23-19-11-16(4-3-15(19)9-10-26-23)17-5-8-21-20(12-17)22(29-28-21)24(31)27-13-14-1-6-18(30)7-2-14/h3-5,8-12,14,18,30H,1-2,6-7,13H2,(H2,25,26)(H,27,31)(H,28,29) |
| InChIKey | VDYCGKOLWCZRNI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |