C25H25N3O2 — CID 164625682
5-[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 164625682) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 5-[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164625682 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 5-[4-(furan-3-yl)phenyl]-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCC1CCNCC1)c1cc2cc(-c3ccc(-c4ccoc4)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C25H25N3O2/c29-25(27-15-17-7-10-26-11-8-17)24-14-22-13-20(5-6-23(22)28-24)18-1-3-19(4-2-18)21-9-12-30-16-21/h1-6,9,12-14,16-17,26,28H,7-8,10-11,15H2,(H,27,29) |
| InChIKey | UWMGRDBOPBRMFA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |